C25H30NO5+ — CID 2390435
(3Z,5E)-3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one (PubChem CID 2390435) has the molecular formula C25H30NO5+ and a molecular weight of 424.52 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 2390435 |
| Molecular Formula | C25H30NO5+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (3Z,5E)-3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-ethylpiperidin-1-ium-4-one |
| SMILES | CC[NH+]1C/C(=C/c2cccc(OC)c2OC)C(=O)/C(=C/c2cccc(OC)c2OC)C1 |
| InChI | InChI=1S/C25H29NO5/c1-6-26-15-19(13-17-9-7-11-21(28-2)24(17)30-4)23(27)20(16-26)14-18-10-8-12-22(29-3)25(18)31-5/h7-14H,6,15-16H2,1-5H3/p+1/b19-13-,20-14+ |
| InChIKey | RFNXRLVGGAQWGE-LRVMPXQBSA-O |
| XLogP | 2.68 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|