C19H24O3 — CID 3709426
2-cyclopentyl-5-[(2,3-dimethoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 3709426) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-cyclopentyl-5-[(2,3-dimethoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | 2-cyclopentyl-5-[(2,3-dimethoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 3709426 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-cyclopentyl-5-[(2,3-dimethoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cccc(C=C2CCC(C3CCCC3)C2=O)c1OC |
| InChI | InChI=1S/C19H24O3/c1-21-17-9-5-8-15(19(17)22-2)12-14-10-11-16(18(14)20)13-6-3-4-7-13/h5,8-9,12-13,16H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | QFCPGGBPTDDVEU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|