C26H31NO5 — CID 1067759
3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 1067759) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-propylpiperidin-4-one.
| Compound Name | 3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 1067759 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3,5-bis[(2,3-dimethoxyphenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1CC(=Cc2cccc(OC)c2OC)C(=O)C(=Cc2cccc(OC)c2OC)C1 |
| InChI | InChI=1S/C26H31NO5/c1-6-13-27-16-20(14-18-9-7-11-22(29-2)25(18)31-4)24(28)21(17-27)15-19-10-8-12-23(30-3)26(19)32-5/h7-12,14-15H,6,13,16-17H2,1-5H3 |
| InChIKey | TUTNWNLXFZPBGL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|