C25H28O4 — CID 157263030
(2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(2-methoxy-3-methylphenyl)methylidene]-4-methylcyclohexan-1-one (PubChem CID 157263030) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(2-methoxy-3-methylphenyl)methylidene]-4-methylcyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(2-methoxy-3-methylphenyl)methylidene]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 157263030 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2E,6E)-2-[(2,3-dimethoxyphenyl)methylidene]-6-[(2-methoxy-3-methylphenyl)methylidene]-4-methylcyclohexan-1-one |
| SMILES | COc1cccc(/C=C2\CC(C)C/C(=C\c3cccc(C)c3OC)C2=O)c1OC |
| InChI | InChI=1S/C25H28O4/c1-16-12-20(14-18-9-6-8-17(2)24(18)28-4)23(26)21(13-16)15-19-10-7-11-22(27-3)25(19)29-5/h6-11,14-16H,12-13H2,1-5H3/b20-14+,21-15+ |
| InChIKey | IEIFEFOQLKTGPE-OZNQKUEASA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|