C26H29NO5 — CID 98185544
(1R,2E,4Z,5R)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 98185544) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is (1R,2E,4Z,5R)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2E,4Z,5R)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98185544 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (1R,2E,4Z,5R)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | COc1cccc(/C=C2\C(=O)/C(=C/c3cccc(OC)c3OC)[C@H]3CC[C@H]2N3C)c1OC |
| InChI | InChI=1S/C26H29NO5/c1-27-20-12-13-21(27)19(15-17-9-7-11-23(30-3)26(17)32-5)24(28)18(20)14-16-8-6-10-22(29-2)25(16)31-4/h6-11,14-15,20-21H,12-13H2,1-5H3/b18-14-,19-15+/t20-,21-/m1/s1 |
| InChIKey | ZEIYZPHCACFGPC-GJVFCADDSA-N |
| XLogP | 4.23 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|