C28H33NO5 — CID 155812722
(1R,2E,4E,5S)-2,4-bis[(2,5-dimethoxyphenyl)methylidene]-8-propyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 155812722) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is (1R,2E,4E,5S)-2,4-bis[(2,5-dimethoxyphenyl)methylidene]-8-propyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2E,4E,5S)-2,4-bis[(2,5-dimethoxyphenyl)methylidene]-8-propyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 155812722 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (1R,2E,4E,5S)-2,4-bis[(2,5-dimethoxyphenyl)methylidene]-8-propyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CCCN1[C@@H]2CC[C@H]1/C(=C\c1cc(OC)ccc1OC)C(=O)/C2=C/c1cc(OC)ccc1OC |
| InChI | InChI=1S/C28H33NO5/c1-6-13-29-24-9-10-25(29)23(17-19-15-21(32-3)8-12-27(19)34-5)28(30)22(24)16-18-14-20(31-2)7-11-26(18)33-4/h7-8,11-12,14-17,24-25H,6,9-10,13H2,1-5H3/b22-16+,23-17+/t24-,25+ |
| InChIKey | HKUMCSDNGZFMME-RZQKHREGSA-N |
| XLogP | 5.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|