C28H33NO7 — CID 98185570
(1R,2E,4E,5R)-8-methyl-2,4-bis[(3,4,5-trimethoxyphenyl)methylidene]-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 98185570) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is (1R,2E,4E,5R)-8-methyl-2,4-bis[(3,4,5-trimethoxyphenyl)methylidene]-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2E,4E,5R)-8-methyl-2,4-bis[(3,4,5-trimethoxyphenyl)methylidene]-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98185570 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (1R,2E,4E,5R)-8-methyl-2,4-bis[(3,4,5-trimethoxyphenyl)methylidene]-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | COc1cc(/C=C2/C(=O)/C(=C/c3cc(OC)c(OC)c(OC)c3)[C@H]3CC[C@H]2N3C)cc(OC)c1OC |
| InChI | InChI=1S/C28H33NO7/c1-29-20-8-9-21(29)19(11-17-14-24(33-4)28(36-7)25(15-17)34-5)26(30)18(20)10-16-12-22(31-2)27(35-6)23(13-16)32-3/h10-15,20-21H,8-9H2,1-7H3/b18-10+,19-11+/t20-,21-/m1/s1 |
| InChIKey | NJOXYNZFHACETL-KMVCDMAPSA-N |
| XLogP | 4.25 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|