C15H17NO4 — CID 162673644
(3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyridin-4-one (PubChem CID 162673644) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyridin-4-one.
| Compound Name | (3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyridin-4-one |
|---|---|
| PubChem CID | 162673644 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (3E)-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyridin-4-one |
| SMILES | COc1cc(/C=C2\CNC=CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C15H17NO4/c1-18-13-7-10(8-14(19-2)15(13)20-3)6-11-9-16-5-4-12(11)17/h4-8,16H,9H2,1-3H3/b11-6+ |
| InChIKey | QSMDQTKMEXUMSD-IZZDOVSWSA-N |
| XLogP | 1.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|