C24H24Br2O5 — CID 11838038
(2E,6Z)-2,6-bis[(3-bromo-4,5-dimethoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 11838038) has the molecular formula C24H24Br2O5 and a molecular weight of 552.26 g/mol. Its IUPAC name is (2E,6Z)-2,6-bis[(3-bromo-4,5-dimethoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6Z)-2,6-bis[(3-bromo-4,5-dimethoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 11838038 |
| Molecular Formula | C24H24Br2O5 |
| Molecular Weight | 552.26 g/mol |
| Exact Mass | 550.00 |
| IUPAC Name | (2E,6Z)-2,6-bis[(3-bromo-4,5-dimethoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2/CCC/C(=C\c3cc(Br)c(OC)c(OC)c3)C2=O)cc(Br)c1OC |
| InChI | InChI=1S/C24H24Br2O5/c1-28-20-12-14(10-18(25)23(20)30-3)8-16-6-5-7-17(22(16)27)9-15-11-19(26)24(31-4)21(13-15)29-2/h8-13H,5-7H2,1-4H3/b16-8-,17-9+ |
| InChIKey | XKOGVJHQPCQHCO-VAQFQWRASA-N |
| XLogP | 6.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.26 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|