C12H11BrN2O3S — CID 2164881
(5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 2164881) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2164881 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2\NC(=S)NC2=O)cc(Br)c1OC |
| InChI | InChI=1S/C12H11BrN2O3S/c1-17-9-5-6(3-7(13)10(9)18-2)4-8-11(16)15-12(19)14-8/h3-5H,1-2H3,(H2,14,15,16,19)/b8-4- |
| InChIKey | LGRSRQWGNDXKDV-YWEYNIOJSA-N |
| XLogP | 1.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|