C13H10BrN3O4 — CID 7028523
2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 7028523) has the molecular formula C13H10BrN3O4 and a molecular weight of 352.14 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 7028523 |
| Molecular Formula | C13H10BrN3O4 |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=C2/NC(=O)NC2=O)cc(Br)c1OCC#N |
| InChI | InChI=1S/C13H10BrN3O4/c1-20-10-6-7(4-8(14)11(10)21-3-2-15)5-9-12(18)17-13(19)16-9/h4-6H,3H2,1H3,(H2,16,17,18,19)/b9-5+ |
| InChIKey | FLGFNKIFXAPBHG-WEVVVXLNSA-N |
| XLogP | 1.54 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|