C19H13BrFN3O3S — CID 137035764
2-[2-bromo-4-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 137035764) has the molecular formula C19H13BrFN3O3S and a molecular weight of 462.30 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 137035764 |
| Molecular Formula | C19H13BrFN3O3S |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(F)cc3)NC2=O)cc(Br)c1OCC#N |
| InChI | InChI=1S/C19H13BrFN3O3S/c1-26-15-9-11(8-14(20)17(15)27-7-6-22)10-16-18(25)24-19(28-16)23-13-4-2-12(21)3-5-13/h2-5,8-10H,7H2,1H3,(H,23,24,25)/b16-10- |
| InChIKey | VWUHJMWJRGVOEA-YBEGLDIGSA-N |
| XLogP | 4.39 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|