C21H17BrN4O5S — CID 137035766
2-[2-bromo-4-[(Z)-[2-(3,4-dimethyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile (PubChem CID 137035766) has the molecular formula C21H17BrN4O5S and a molecular weight of 517.36 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[2-(3,4-dimethyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(Z)-[2-(3,4-dimethyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 137035766 |
| Molecular Formula | C21H17BrN4O5S |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[2-(3,4-dimethyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cc(C)c(C)c([N+](=O)[O-])c3)NC2=O)cc(Br)c1OCC#N |
| InChI | InChI=1S/C21H17BrN4O5S/c1-11-6-14(10-16(12(11)2)26(28)29)24-21-25-20(27)18(32-21)9-13-7-15(22)19(31-5-4-23)17(8-13)30-3/h6-10H,5H2,1-3H3,(H,24,25,27)/b18-9- |
| InChIKey | XICMQWGDXVMSFD-NVMNQCDNSA-N |
| XLogP | 4.78 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|