C20H14BrI2N3O2S — CID 137021437
2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetonitrile (PubChem CID 137021437) has the molecular formula C20H14BrI2N3O2S and a molecular weight of 694.13 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetonitrile.
| Compound Name | 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetonitrile |
|---|---|
| PubChem CID | 137021437 |
| Molecular Formula | C20H14BrI2N3O2S |
| Molecular Weight | 694.13 g/mol |
| Exact Mass | 692.81 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetonitrile |
| SMILES | Cc1cc(/N=C2\NC(=O)/C(=C/c3cc(I)c(OCC#N)c(I)c3)S2)cc(C)c1Br |
| InChI | InChI=1S/C20H14BrI2N3O2S/c1-10-5-13(6-11(2)17(10)21)25-20-26-19(27)16(29-20)9-12-7-14(22)18(15(23)8-12)28-4-3-24/h5-9H,4H2,1-2H3,(H,25,26,27)/b16-9- |
| InChIKey | OKNRJKJHYXTUJY-SXGWCWSVSA-N |
| XLogP | 6.07 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.13 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|