C20H17BrCl2N2O2S — CID 137020424
(5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137020424) has the molecular formula C20H17BrCl2N2O2S and a molecular weight of 500.25 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020424 |
| Molecular Formula | C20H17BrCl2N2O2S |
| Molecular Weight | 500.25 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1c(Cl)cc(/C=C2\S/C(=N/c3cc(C)c(Br)c(C)c3)NC2=O)cc1Cl |
| InChI | InChI=1S/C20H17BrCl2N2O2S/c1-4-27-18-14(22)7-12(8-15(18)23)9-16-19(26)25-20(28-16)24-13-5-10(2)17(21)11(3)6-13/h5-9H,4H2,1-3H3,(H,24,25,26)/b16-9- |
| InChIKey | VZFRGPFBJDWEDU-SXGWCWSVSA-N |
| XLogP | 6.66 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.25 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|