C22H20Br2N2O4S — CID 137021293
ethyl 2-[2-bromo-4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 137021293) has the molecular formula C22H20Br2N2O4S and a molecular weight of 568.29 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137021293 |
| Molecular Formula | C22H20Br2N2O4S |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 565.95 |
| IUPAC Name | ethyl 2-[2-bromo-4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2\S/C(=N/c3cc(C)c(Br)c(C)c3)NC2=O)cc1Br |
| InChI | InChI=1S/C22H20Br2N2O4S/c1-4-29-19(27)11-30-17-6-5-14(9-16(17)23)10-18-21(28)26-22(31-18)25-15-7-12(2)20(24)13(3)8-15/h5-10H,4,11H2,1-3H3,(H,25,26,28)/b18-10- |
| InChIKey | KGZQMSHJXHUXLC-ZDLGFXPLSA-N |
| XLogP | 5.66 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|