C22H21BrN2O4S — CID 135399344
ethyl 2-[2-bromo-4-[[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 135399344) has the molecular formula C22H21BrN2O4S and a molecular weight of 489.39 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 135399344 |
| Molecular Formula | C22H21BrN2O4S |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | ethyl 2-[2-bromo-4-[[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=C2S/C(=N\c3ccc(CC)cc3)NC2=O)cc1Br |
| InChI | InChI=1S/C22H21BrN2O4S/c1-3-14-5-8-16(9-6-14)24-22-25-21(27)19(30-22)12-15-7-10-18(17(23)11-15)29-13-20(26)28-4-2/h5-12H,3-4,13H2,1-2H3,(H,24,25,27) |
| InChIKey | JVGDZBXTRHEWIC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|