C23H23BrN2O5S — CID 137051182
ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 137051182) has the molecular formula C23H23BrN2O5S and a molecular weight of 519.42 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137051182 |
| Molecular Formula | C23H23BrN2O5S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | ethyl 2-[2-bromo-6-ethoxy-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2/S/C(=N\c3ccc(C)cc3)NC2=O)cc1OCC |
| InChI | InChI=1S/C23H23BrN2O5S/c1-4-29-18-11-15(10-17(24)21(18)31-13-20(27)30-5-2)12-19-22(28)26-23(32-19)25-16-8-6-14(3)7-9-16/h6-12H,4-5,13H2,1-3H3,(H,25,26,28)/b19-12+ |
| InChIKey | YPDFMKWKNGLDKB-XDHOZWIPSA-N |
| XLogP | 4.99 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|