C27H23BrN2O5S — CID 137069715
[2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 137069715) has the molecular formula C27H23BrN2O5S and a molecular weight of 567.46 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 137069715 |
| Molecular Formula | C27H23BrN2O5S |
| Molecular Weight | 567.46 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(C)cc3)NC2=O)cc(Br)c1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H23BrN2O5S/c1-4-34-22-14-17(13-21(28)24(22)35-26(32)18-7-11-20(33-3)12-8-18)15-23-25(31)30-27(36-23)29-19-9-5-16(2)6-10-19/h5-15H,4H2,1-3H3,(H,29,30,31)/b23-15- |
| InChIKey | VABZOJOMKVRJRH-HAHDFKILSA-N |
| XLogP | 6.28 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|