C19H14Br2N2O5S — CID 137051049
2-[2,6-dibromo-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 137051049) has the molecular formula C19H14Br2N2O5S and a molecular weight of 542.21 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137051049 |
| Molecular Formula | C19H14Br2N2O5S |
| Molecular Weight | 542.21 g/mol |
| Exact Mass | 539.90 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1ccc(/N=C2/NC(=O)/C(=C\c3cc(Br)c(OCC(=O)O)c(Br)c3)S2)cc1 |
| InChI | InChI=1S/C19H14Br2N2O5S/c1-27-12-4-2-11(3-5-12)22-19-23-18(26)15(29-19)8-10-6-13(20)17(14(21)7-10)28-9-16(24)25/h2-8H,9H2,1H3,(H,24,25)(H,22,23,26)/b15-8+ |
| InChIKey | VWIMXENQWLZVJC-OVCLIPMQSA-N |
| XLogP | 4.58 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.21 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|