C18H10Br2Cl2N2O4S — CID 137063223
2-[2,6-dibromo-4-[(E)-[2-(2,5-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 137063223) has the molecular formula C18H10Br2Cl2N2O4S and a molecular weight of 581.07 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[2-(2,5-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[2-(2,5-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137063223 |
| Molecular Formula | C18H10Br2Cl2N2O4S |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 577.81 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[2-(2,5-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2/S/C(=N\c3cc(Cl)ccc3Cl)NC2=O)cc1Br |
| InChI | InChI=1S/C18H10Br2Cl2N2O4S/c19-10-3-8(4-11(20)16(10)28-7-15(25)26)5-14-17(27)24-18(29-14)23-13-6-9(21)1-2-12(13)22/h1-6H,7H2,(H,25,26)(H,23,24,27)/b14-5+ |
| InChIKey | UNCULIKHPUSPFV-LHHJGKSTSA-N |
| XLogP | 5.87 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|