C21H17BrCl2N2O4S — CID 137129089
ethyl 2-[2-bromo-6-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 137129089) has the molecular formula C21H17BrCl2N2O4S and a molecular weight of 544.25 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137129089 |
| Molecular Formula | C21H17BrCl2N2O4S |
| Molecular Weight | 544.25 g/mol |
| Exact Mass | 541.95 |
| IUPAC Name | ethyl 2-[2-bromo-6-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)cc1Br |
| InChI | InChI=1S/C21H17BrCl2N2O4S/c1-3-29-18(27)10-30-19-13(22)7-12(8-15(19)24)9-17-20(28)26-21(31-17)25-16-6-4-5-14(23)11(16)2/h4-9H,3,10H2,1-2H3,(H,25,26,28)/b17-9+ |
| InChIKey | JFIFCGSOLFYWMB-RQZCQDPDSA-N |
| XLogP | 5.90 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.25 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|