C21H18Cl2N2O5S — CID 137077320
2-[2-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 137077320) has the molecular formula C21H18Cl2N2O5S and a molecular weight of 481.36 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 137077320 |
| Molecular Formula | C21H18Cl2N2O5S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C21H18Cl2N2O5S/c1-3-29-16-8-12(7-14(23)19(16)30-10-18(26)27)9-17-20(28)25-21(31-17)24-15-6-4-5-13(22)11(15)2/h4-9H,3,10H2,1-2H3,(H,26,27)(H,24,25,28)/b17-9+ |
| InChIKey | KQTNTSAHBRHLAU-RQZCQDPDSA-N |
| XLogP | 5.06 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|