C21H19ClN2O6S — CID 137080134
2-[2-chloro-6-ethoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 137080134) has the molecular formula C21H19ClN2O6S and a molecular weight of 462.91 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137080134 |
| Molecular Formula | C21H19ClN2O6S |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)NC2=O)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C21H19ClN2O6S/c1-3-29-16-9-12(8-15(22)19(16)30-11-18(25)26)10-17-20(27)24-21(31-17)23-13-4-6-14(28-2)7-5-13/h4-10H,3,11H2,1-2H3,(H,25,26)(H,23,24,27)/b17-10+ |
| InChIKey | KFQHFAJHGYCQEY-LICLKQGHSA-N |
| XLogP | 4.10 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|