C26H21ClN2O6S — CID 137050474
4-[[2-chloro-6-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 137050474) has the molecular formula C26H21ClN2O6S and a molecular weight of 524.98 g/mol. Its IUPAC name is 4-[[2-chloro-6-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-6-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 137050474 |
| Molecular Formula | C26H21ClN2O6S |
| Molecular Weight | 524.98 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 4-[[2-chloro-6-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1ccc(/N=C2/NC(=O)/C(=C\c3cc(Cl)c(OCc4ccc(C(=O)O)cc4)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C26H21ClN2O6S/c1-33-19-9-7-18(8-10-19)28-26-29-24(30)22(36-26)13-16-11-20(27)23(21(12-16)34-2)35-14-15-3-5-17(6-4-15)25(31)32/h3-13H,14H2,1-2H3,(H,31,32)(H,28,29,30)/b22-13+ |
| InChIKey | KXIDSIGBEMIVCM-LPYMAVHISA-N |
| XLogP | 5.53 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|