C32H26Cl2N2O5S — CID 137070954
(5E)-5-[[3-chloro-5-methoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137070954) has the molecular formula C32H26Cl2N2O5S and a molecular weight of 621.54 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-5-methoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-chloro-5-methoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137070954 |
| Molecular Formula | C32H26Cl2N2O5S |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | (5E)-5-[[3-chloro-5-methoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(COc2c(Cl)cc(/C=C3/S/C(=N\c4ccc(Cl)cc4)NC3=O)cc2OC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H26Cl2N2O5S/c1-38-27-15-21(8-13-26(27)40-18-20-6-4-3-5-7-20)19-41-30-25(34)14-22(16-28(30)39-2)17-29-31(37)36-32(42-29)35-24-11-9-23(33)10-12-24/h3-17H,18-19H2,1-2H3,(H,35,36,37)/b29-17+ |
| InChIKey | WSMXSKUJGLVHNP-STBIYBPSSA-N |
| XLogP | 8.06 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|