C33H30N2O5S — CID 137071096
(5E)-5-[[3-ethoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137071096) has the molecular formula C33H30N2O5S and a molecular weight of 566.68 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137071096 |
| Molecular Formula | C33H30N2O5S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(3-methoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccccc3)NC2=O)ccc1OCc1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C33H30N2O5S/c1-3-38-30-18-24(20-31-32(36)35-33(41-31)34-26-12-8-5-9-13-26)14-16-28(30)40-22-25-15-17-27(29(19-25)37-2)39-21-23-10-6-4-7-11-23/h4-20H,3,21-22H2,1-2H3,(H,34,35,36)/b31-20+ |
| InChIKey | JYNDZPBNIGAMON-AJBULDERSA-N |
| XLogP | 7.14 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|