C26H22Cl2N2O4S — CID 137069530
(5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137069530) has the molecular formula C26H22Cl2N2O4S and a molecular weight of 529.45 g/mol. Its IUPAC name is (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137069530 |
| Molecular Formula | C26H22Cl2N2O4S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(OC)cc3)NC2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H22Cl2N2O4S/c1-3-33-23-13-16(5-11-22(23)34-15-17-4-10-20(27)21(28)12-17)14-24-25(31)30-26(35-24)29-18-6-8-19(32-2)9-7-18/h4-14H,3,15H2,1-2H3,(H,29,30,31)/b24-14- |
| InChIKey | DUHBGSKOUJZNDJ-OYKKKHCWSA-N |
| XLogP | 6.87 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|