C26H23ClN2O4S — CID 135486971
5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2-ethoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135486971) has the molecular formula C26H23ClN2O4S and a molecular weight of 495.00 g/mol. Its IUPAC name is 5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2-ethoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2-ethoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135486971 |
| Molecular Formula | C26H23ClN2O4S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(2-ethoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccccc1/N=C1/NC(=O)C(=Cc2ccc(OCc3ccc(Cl)cc3)c(OC)c2)S1 |
| InChI | InChI=1S/C26H23ClN2O4S/c1-3-32-21-7-5-4-6-20(21)28-26-29-25(30)24(34-26)15-18-10-13-22(23(14-18)31-2)33-16-17-8-11-19(27)12-9-17/h4-15H,3,16H2,1-2H3,(H,28,29,30) |
| InChIKey | FALAWKGMEYKSFH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|