C25H20Cl2N2O3S — CID 137140558
(5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137140558) has the molecular formula C25H20Cl2N2O3S and a molecular weight of 499.42 g/mol. Its IUPAC name is (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137140558 |
| Molecular Formula | C25H20Cl2N2O3S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3cc(Cl)ccc3C)NC2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20Cl2N2O3S/c1-15-3-7-19(27)13-20(15)28-25-29-24(30)23(33-25)12-17-6-10-21(22(11-17)31-2)32-14-16-4-8-18(26)9-5-16/h3-13H,14H2,1-2H3,(H,28,29,30)/b23-12- |
| InChIKey | KXJCQYALQIWKTA-FMCGGJTJSA-N |
| XLogP | 6.78 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|