C24H19FN2O4S — CID 135599279
(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135599279) has the molecular formula C24H19FN2O4S and a molecular weight of 450.49 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135599279 |
| Molecular Formula | C24H19FN2O4S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-hydroxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(O)cc3)NC2=O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2O4S/c1-30-21-12-16(4-11-20(21)31-14-15-2-5-17(25)6-3-15)13-22-23(29)27-24(32-22)26-18-7-9-19(28)10-8-18/h2-13,28H,14H2,1H3,(H,26,27,29)/b22-13- |
| InChIKey | MHCGZQDNLKEOCJ-XKZIYDEJSA-N |
| XLogP | 5.01 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|