C24H17Cl2FN2O3S — CID 137074100
(5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137074100) has the molecular formula C24H17Cl2FN2O3S and a molecular weight of 503.38 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137074100 |
| Molecular Formula | C24H17Cl2FN2O3S |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2-(4-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17Cl2FN2O3S/c1-31-20-11-15(10-19(26)22(20)32-13-14-2-6-17(27)7-3-14)12-21-23(30)29-24(33-21)28-18-8-4-16(25)5-9-18/h2-12H,13H2,1H3,(H,28,29,30)/b21-12- |
| InChIKey | HNTIJJLYSKFZNV-MTJSOVHGSA-N |
| XLogP | 6.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|