C35H33ClN2O5S — CID 137070907
(5E)-5-[[3-chloro-5-ethoxy-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137070907) has the molecular formula C35H33ClN2O5S and a molecular weight of 629.18 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-5-ethoxy-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-chloro-5-ethoxy-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137070907 |
| Molecular Formula | C35H33ClN2O5S |
| Molecular Weight | 629.18 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | (5E)-5-[[3-chloro-5-ethoxy-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(COc2c(Cl)cc(/C=C3/S/C(=N\c4ccc(C)cc4)NC3=O)cc2OCC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H33ClN2O5S/c1-4-40-30-18-25(13-16-29(30)42-21-24-9-7-6-8-10-24)22-43-33-28(36)17-26(19-31(33)41-5-2)20-32-34(39)38-35(44-32)37-27-14-11-23(3)12-15-27/h6-20H,4-5,21-22H2,1-3H3,(H,37,38,39)/b32-20+ |
| InChIKey | KUJLFDQTERNJMB-UZWMFBFFSA-N |
| XLogP | 8.50 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.18 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|