C22H21ClN2O3S — CID 137074297
(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137074297) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is (5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137074297 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\S/C(=N/c3ccc(C)cc3)NC2=O)cc1OCC |
| InChI | InChI=1S/C22H21ClN2O3S/c1-4-10-28-20-17(23)11-15(12-18(20)27-5-2)13-19-21(26)25-22(29-19)24-16-8-6-14(3)7-9-16/h4,6-9,11-13H,1,5,10H2,2-3H3,(H,24,25,26)/b19-13- |
| InChIKey | IOENKPKZGTYLAK-UYRXBGFRSA-N |
| XLogP | 5.50 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|