C21H18FIN2O3S — CID 137025013
(5E)-5-[(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137025013) has the molecular formula C21H18FIN2O3S and a molecular weight of 524.36 g/mol. Its IUPAC name is (5E)-5-[(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137025013 |
| Molecular Formula | C21H18FIN2O3S |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | (5E)-5-[(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(I)cc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)cc1OCC |
| InChI | InChI=1S/C21H18FIN2O3S/c1-3-9-28-19-16(23)10-13(11-17(19)27-4-2)12-18-20(26)25-21(29-18)24-15-7-5-14(22)6-8-15/h3,5-8,10-12H,1,4,9H2,2H3,(H,24,25,26)/b18-12+ |
| InChIKey | ZQBKLYGTOCAIGL-LDADJPATSA-N |
| XLogP | 5.29 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|