C25H18Cl2FIN2O3S — CID 137090134
(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137090134) has the molecular formula C25H18Cl2FIN2O3S and a molecular weight of 643.31 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137090134 |
| Molecular Formula | C25H18Cl2FIN2O3S |
| Molecular Weight | 643.31 g/mol |
| Exact Mass | 641.94 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H18Cl2FIN2O3S/c1-2-33-21-10-14(9-20(29)23(21)34-13-15-3-4-16(26)12-19(15)27)11-22-24(32)31-25(35-22)30-18-7-5-17(28)6-8-18/h3-12H,2,13H2,1H3,(H,30,31,32)/b22-11+ |
| InChIKey | KSWCGQOZNFSRJX-SSDVNMTOSA-N |
| XLogP | 7.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.31 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|