C26H21Cl2IN2O4S — CID 137050842
(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137050842) has the molecular formula C26H21Cl2IN2O4S and a molecular weight of 655.34 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137050842 |
| Molecular Formula | C26H21Cl2IN2O4S |
| Molecular Weight | 655.34 g/mol |
| Exact Mass | 653.96 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)NC2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H21Cl2IN2O4S/c1-3-34-22-11-15(10-21(29)24(22)35-14-16-4-5-17(27)13-20(16)28)12-23-25(32)31-26(36-23)30-18-6-8-19(33-2)9-7-18/h4-13H,3,14H2,1-2H3,(H,30,31,32)/b23-12+ |
| InChIKey | QQKFZISWIVVRMF-FSJBWODESA-N |
| XLogP | 7.48 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.34 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|