C25H21IN2O4S — CID 137021167
(5Z)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137021167) has the molecular formula C25H21IN2O4S and a molecular weight of 572.42 g/mol. Its IUPAC name is (5Z)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137021167 |
| Molecular Formula | C25H21IN2O4S |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | (5Z)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C/c3cc(I)c(OCc4ccccc4)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C25H21IN2O4S/c1-30-19-10-8-18(9-11-19)27-25-28-24(29)22(33-25)14-17-12-20(26)23(21(13-17)31-2)32-15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3,(H,27,28,29)/b22-14- |
| InChIKey | KMDJQBCRTOYFAZ-HMAPJEAMSA-N |
| XLogP | 5.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|