C26H22IN3O6S — CID 137050551
(5E)-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137050551) has the molecular formula C26H22IN3O6S and a molecular weight of 631.45 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137050551 |
| Molecular Formula | C26H22IN3O6S |
| Molecular Weight | 631.45 g/mol |
| Exact Mass | 631.03 |
| IUPAC Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)NC2=O)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H22IN3O6S/c1-3-35-22-13-17(12-21(27)24(22)36-15-16-4-8-19(9-5-16)30(32)33)14-23-25(31)29-26(37-23)28-18-6-10-20(34-2)11-7-18/h4-14H,3,15H2,1-2H3,(H,28,29,31)/b23-14+ |
| InChIKey | LSDOIXYLXXRBKW-OEAKJJBVSA-N |
| XLogP | 6.08 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|