C24H17I2N3O4S — CID 137079898
(5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137079898) has the molecular formula C24H17I2N3O4S and a molecular weight of 697.29 g/mol. Its IUPAC name is (5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137079898 |
| Molecular Formula | C24H17I2N3O4S |
| Molecular Weight | 697.29 g/mol |
| Exact Mass | 696.90 |
| IUPAC Name | (5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)/C(=C\c3cc(I)c(OCc4ccc([N+](=O)[O-])cc4)c(I)c3)S2)cc1 |
| InChI | InChI=1S/C24H17I2N3O4S/c1-14-2-6-17(7-3-14)27-24-28-23(30)21(34-24)12-16-10-19(25)22(20(26)11-16)33-13-15-4-8-18(9-5-15)29(31)32/h2-12H,13H2,1H3,(H,27,28,30)/b21-12+ |
| InChIKey | BTFULMLLEYEJAN-CIAFOILYSA-N |
| XLogP | 6.58 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.29 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|