C25H19BrI2N2O2S — CID 137020547
(5Z)-5-[[3-bromo-5-iodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137020547) has the molecular formula C25H19BrI2N2O2S and a molecular weight of 745.22 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-iodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-5-iodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020547 |
| Molecular Formula | C25H19BrI2N2O2S |
| Molecular Weight | 745.22 g/mol |
| Exact Mass | 743.84 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-iodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\NC(=O)/C(=C/c3cc(Br)c(OCc4ccc(I)cc4)c(I)c3)S2)cc1 |
| InChI | InChI=1S/C25H19BrI2N2O2S/c1-2-15-5-9-19(10-6-15)29-25-30-24(31)22(33-25)13-17-11-20(26)23(21(28)12-17)32-14-16-3-7-18(27)8-4-16/h3-13H,2,14H2,1H3,(H,29,30,31)/b22-13- |
| InChIKey | YTUDGNUVXNSPAD-XKZIYDEJSA-N |
| XLogP | 7.69 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.22 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|