C26H20BrIN2O4S — CID 137020186
(5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-iodophenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137020186) has the molecular formula C26H20BrIN2O4S and a molecular weight of 663.33 g/mol. Its IUPAC name is (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-iodophenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-iodophenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020186 |
| Molecular Formula | C26H20BrIN2O4S |
| Molecular Weight | 663.33 g/mol |
| Exact Mass | 661.94 |
| IUPAC Name | (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-iodophenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\NC(=O)/C(=C/c3cc(Br)c(OCc4ccc5c(c4)OCO5)c(I)c3)S2)cc1 |
| InChI | InChI=1S/C26H20BrIN2O4S/c1-2-15-3-6-18(7-4-15)29-26-30-25(31)23(35-26)12-17-9-19(27)24(20(28)10-17)32-13-16-5-8-21-22(11-16)34-14-33-21/h3-12H,2,13-14H2,1H3,(H,29,30,31)/b23-12- |
| InChIKey | SYNWQZHFWSEWHA-FMCGGJTJSA-N |
| XLogP | 6.82 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.33 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|