C26H22N2O4S — CID 137020264
(5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137020264) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137020264 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(OCc4ccc5c(c4)OCO5)cc3)S2)cc1 |
| InChI | InChI=1S/C26H22N2O4S/c1-2-17-3-8-20(9-4-17)27-26-28-25(29)24(33-26)14-18-5-10-21(11-6-18)30-15-19-7-12-22-23(13-19)32-16-31-22/h3-14H,2,15-16H2,1H3,(H,27,28,29)/b24-14- |
| InChIKey | KRUYNIWIFUSBCR-OYKKKHCWSA-N |
| XLogP | 5.45 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|