C19H13N3O4S — CID 136596877
[5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]cyanamide (PubChem CID 136596877) has the molecular formula C19H13N3O4S and a molecular weight of 379.40 g/mol. Its IUPAC name is [5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]cyanamide.
| Compound Name | [5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 136596877 |
| Molecular Formula | C19H13N3O4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]cyanamide |
| SMILES | N#C/N=C1\NC(=O)C(=Cc2ccc(OCc3ccc4c(c3)OCO4)cc2)S1 |
| InChI | InChI=1S/C19H13N3O4S/c20-10-21-19-22-18(23)17(27-19)8-12-1-4-14(5-2-12)24-9-13-3-6-15-16(7-13)26-11-25-15/h1-8H,9,11H2,(H,21,22,23) |
| InChIKey | BZIJJFWSVBPNFG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|