C25H18FNO5S — CID 6534028
(5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 6534028) has the molecular formula C25H18FNO5S and a molecular weight of 463.49 g/mol. Its IUPAC name is (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6534028 |
| Molecular Formula | C25H18FNO5S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (5Z)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(OCc3ccc4c(c3)OCO4)cc2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H18FNO5S/c26-19-6-1-17(2-7-19)13-27-24(28)23(33-25(27)29)12-16-3-8-20(9-4-16)30-14-18-5-10-21-22(11-18)32-15-31-21/h1-12H,13-15H2/b23-12- |
| InChIKey | KOVGEWCISYANHZ-FMCGGJTJSA-N |
| XLogP | 5.37 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|