C23H21FN2O5S — CID 124663893
(5E)-3-[(4-fluorophenyl)methyl]-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124663893) has the molecular formula C23H21FN2O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is (5E)-3-[(4-fluorophenyl)methyl]-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-fluorophenyl)methyl]-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124663893 |
| Molecular Formula | C23H21FN2O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (5E)-3-[(4-fluorophenyl)methyl]-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(COc1ccc(/C=C2/SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H21FN2O5S/c24-18-5-1-17(2-6-18)14-26-22(28)20(32-23(26)29)13-16-3-7-19(8-4-16)31-15-21(27)25-9-11-30-12-10-25/h1-8,13H,9-12,14-15H2/b20-13+ |
| InChIKey | RNGDOGUFVPIUIG-DEDYPNTBSA-N |
| XLogP | 3.30 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|