C20H15NO7S — CID 18864298
4-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 18864298) has the molecular formula C20H15NO7S and a molecular weight of 413.41 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 18864298 |
| Molecular Formula | C20H15NO7S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-[[(5Z)-5-[[4-(carboxymethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)COc1ccc(/C=C2\SC(=O)N(Cc3ccc(C(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H15NO7S/c22-17(23)11-28-15-7-3-12(4-8-15)9-16-18(24)21(20(27)29-16)10-13-1-5-14(6-2-13)19(25)26/h1-9H,10-11H2,(H,22,23)(H,25,26)/b16-9- |
| InChIKey | HGHPGPKDIMQMJQ-SXGWCWSVSA-N |
| XLogP | 3.08 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|