C25H19NO5S — CID 1232058
4-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 1232058) has the molecular formula C25H19NO5S and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 1232058 |
| Molecular Formula | C25H19NO5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 4-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(C=C3SC(=O)N(Cc4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H19NO5S/c27-23-22(32-25(30)26(23)15-18-4-2-1-3-5-18)14-17-8-12-21(13-9-17)31-16-19-6-10-20(11-7-19)24(28)29/h1-14H,15-16H2,(H,28,29) |
| InChIKey | HBIWSQZBIJYGNF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|