C20H17NO5S — CID 6377667
methyl 2-[(5E)-2,4-dioxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 6377667) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is methyl 2-[(5E)-2,4-dioxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-2,4-dioxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 6377667 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | methyl 2-[(5E)-2,4-dioxo-5-[(4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C/c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C20H17NO5S/c1-25-18(22)12-21-19(23)17(27-20(21)24)11-14-7-9-16(10-8-14)26-13-15-5-3-2-4-6-15/h2-11H,12-13H2,1H3/b17-11+ |
| InChIKey | OABVDEDXVDSPBQ-GZTJUZNOSA-N |
| XLogP | 3.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|