C22H19NO8S — CID 18864304
2-[2-methoxy-4-[(Z)-[3-[(4-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 18864304) has the molecular formula C22H19NO8S and a molecular weight of 457.46 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[3-[(4-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(Z)-[3-[(4-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 18864304 |
| Molecular Formula | C22H19NO8S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[3-[(4-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C\c3ccc(OCC(=O)O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H19NO8S/c1-29-17-9-14(5-8-16(17)31-12-19(24)25)10-18-20(26)23(22(28)32-18)11-13-3-6-15(7-4-13)21(27)30-2/h3-10H,11-12H2,1-2H3,(H,24,25)/b18-10- |
| InChIKey | DAXPITJWCZQXTA-ZDLGFXPLSA-N |
| XLogP | 3.18 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|